ChemNet > CAS > 112399-50-5 2-Bromo-5-fluorobenzyl bromide
112399-50-5 2-Bromo-5-fluorobenzyl bromide
| Produkt-Name |
2-Bromo-5-fluorobenzyl bromide |
| Englischer Name |
2-Bromo-5-fluorobenzyl bromide; 2-Bromo-5-fluorobenzylbromide; 1-bromo-2-(bromomethyl)-4-fluorobenzene; 5-Fluoro-2-Bromobenzyl Bromide |
| Molekulare Formel |
C7H5Br2F |
| Molecular Weight |
267.921 |
| InChI |
InChI=1/C7H5Br2F/c8-4-5-3-6(10)1-2-7(5)9/h1-3H,4H2 |
| CAS Registry Number |
112399-50-5 |
| Molecular Structure |
|
| Dichte |
1.923g/cm3 |
| Siedepunkt |
245.4°C at 760 mmHg |
| Brechungsindex |
1.583 |
| Flammpunkt |
102.2°C |
| Dampfdruck |
0.045mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
