ChemNet > CAS > 1128-76-3 Ethyl 3-chlorobenzoate
1128-76-3 Ethyl 3-chlorobenzoate
| Produkt-Name |
Ethyl 3-chlorobenzoate |
| Englischer Name |
Ethyl 3-chlorobenzoate; 3-Chlorobenzoic acid ethyl ester |
| Molekulare Formel |
C9H9ClO2 |
| Molecular Weight |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| CAS Registry Number |
1128-76-3 |
| EINECS |
214-441-3 |
| Molecular Structure |
|
| Dichte |
1.185g/cm3 |
| Siedepunkt |
243°C at 760 mmHg |
| Brechungsindex |
1.522 |
| Flammpunkt |
115.2°C |
| Dampfdruck |
0.0329mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
