117-34-0 Diphenylacetic acid
Produkt-Name |
Diphenylacetic acid |
Englischer Name |
Diphenylacetic acid; Benzeneacetic acid, alpha-phenyl-; 2,2-Diphenylacetic Acid |
Molekulare Formel |
C14H12O2 |
Molecular Weight |
212.2439 |
InChI |
InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
CAS Registry Number |
117-34-0 |
EINECS |
204-185-0 |
Molecular Structure |
|
Dichte |
1.174g/cm3 |
Schmelzpunkt |
147-149℃ |
Siedepunkt |
285°C at 760 mmHg |
Brechungsindex |
1.599 |
Flammpunkt |
140.4°C |
Dampfdruck |
0.00135mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|