1186-52-3 Acetic-d3 acid-d
Produkt-Name |
Acetic-d3 acid-d |
Englischer Name |
Acetic-d3 acid-d; |
Molekulare Formel |
C2D4O2 |
Molecular Weight |
64.0766 |
InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
CAS Registry Number |
1186-52-3 |
EINECS |
214-693-4 |
Molecular Structure |
|
Dichte |
1.14g/cm3 |
Schmelzpunkt |
15-16℃ |
Siedepunkt |
117.1°C at 760 mmHg |
Brechungsindex |
1.375 |
Flammpunkt |
40°C |
Dampfdruck |
13.9mmHg at 25°C |
Gefahrensymbole |
C:Corrosive;
|
Risk Codes |
R10:Flammable.;
R35:Causes severe burns.;
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|