1198-37-4 2,4-dimethylquinoline
Produkt-Name |
2,4-dimethylquinoline |
Englischer Name |
2,4-dimethylquinoline; Dimethylquinoline |
Molekulare Formel |
C11H11N |
Molecular Weight |
157.2117 |
InChI |
InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
CAS Registry Number |
1198-37-4 |
EINECS |
214-832-9 |
Molecular Structure |
|
Dichte |
1.052g/cm3 |
Siedepunkt |
263.8°C at 760 mmHg |
Brechungsindex |
1.61 |
Flammpunkt |
107.6°C |
Dampfdruck |
0.0164mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|