120-44-5 Desoxyanisoin
Produkt-Name |
Desoxyanisoin |
Englischer Name |
Desoxyanisoin; 4-Methoxy-2-(4-methoxyphenyl)acetophenone; Desoxyanisoin~4-Methoxybenzyl 4-methoxyphenyl ketone; 4,4-dimethoxydeoxybenzoin; 4-methoxybenzyl 4-methoxyphenyl ketone; Deoxyanisoin; 1,2-bis(4-methoxyphenyl)ethanone |
Molekulare Formel |
C16H16O3 |
Molecular Weight |
256.2964 |
InChI |
InChI=1/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 |
CAS Registry Number |
120-44-5 |
EINECS |
204-396-8 |
Molecular Structure |
|
Dichte |
1.115g/cm3 |
Schmelzpunkt |
109-112℃ |
Siedepunkt |
415.6°C at 760 mmHg |
Brechungsindex |
1.558 |
Flammpunkt |
196.9°C |
Dampfdruck |
4.07E-07mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|