120-50-3 Isobutyl benzoate
Produkt-Name |
Isobutyl benzoate |
Englischer Name |
Isobutyl benzoate; Isobutyl benzoate, (Benzoic acid isobutyl ester); Benzoic acid isobutyl ester |
Molekulare Formel |
C11H14O2 |
Molecular Weight |
178.23
|
InChI |
InChI=1/C11H14O2/c1-9(2)8-13-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
CAS Registry Number |
120-50-3 |
EINECS |
204-401-3 |
Molecular Structure |
|
Dichte |
0.999 |
Siedepunkt |
240-242℃ |
Brechungsindex |
1.493-1.495 |
Flammpunkt |
96℃ |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|