ChemNet > CAS > 120085-63-4 4,5,7-Tri-O-acetyl-2,6-anhydro-3-desoxy-D-lyxo-hept-2-enononitril
120085-63-4 4,5,7-Tri-O-acetyl-2,6-anhydro-3-desoxy-D-lyxo-hept-2-enononitril
| Produkt-Name |
4,5,7-Tri-O-acetyl-2,6-anhydro-3-desoxy-D-lyxo-hept-2-enononitril |
| Synonyme |
(2R,3R,4R)-2-[(acetyloxy)methyl]-6-cyano-3,4-dihydro-2H-pyran-3,4-diyldiacetat (nicht bevorzugter Name) |
| Englischer Name |
4,5,7-Tri-O-acetyl-2,6-anhydro-3-deoxy-D-lyxo-hept-2-enononitrile;(2R,3R,4R)-2-[(acetyloxy)methyl]-6-cyano-3,4-dihydro-2H-pyran-3,4-diyl diacetate (non-preferred name) |
| Molekulare Formel |
C13H15NO7 |
| Molecular Weight |
297.2607 |
| InChI |
InChI=1/C13H15NO7/c1-7(15)18-6-12-13(20-9(3)17)11(19-8(2)16)4-10(5-14)21-12/h4,11-13H,6H2,1-3H3/t11-,12-,13-/m1/s1 |
| CAS Registry Number |
120085-63-4 |
| Molecular Structure |
|
| Dichte |
1.29g/cm3 |
| Siedepunkt |
397.8°C at 760 mmHg |
| Brechungsindex |
1.497 |
| Flammpunkt |
174°C |
| Dampfdruck |
1.54E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
