ChemNet > CAS > 1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentancarbonitril
1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentancarbonitril
| Produkt-Name |
1-(4-Methoxyphenyl)-1-cyclopentancarbonitril |
| Synonyme |
1-(4-Methoxyphenyl)cyclopentancarbonitril |
| Englischer Name |
1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| Molekulare Formel |
C13H15NO |
| Molecular Weight |
201.2643 |
| InChI |
InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| CAS Registry Number |
1206-15-1 |
| EINECS |
214-890-5 |
| Molecular Structure |
|
| Dichte |
1.07g/cm3 |
| Siedepunkt |
346.4°C at 760 mmHg |
| Brechungsindex |
1.543 |
| Flammpunkt |
146.2°C |
| Dampfdruck |
5.76E-05mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
