ChemNet > CAS > 121219-12-3 4-n-Pentylbenzeneboronic acid
121219-12-3 4-n-Pentylbenzeneboronic acid
| Produkt-Name |
4-n-Pentylbenzeneboronic acid |
| Englischer Name |
4-n-Pentylbenzeneboronic acid; 4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
| Molekulare Formel |
C11H17BO2 |
| Molecular Weight |
192.0625 |
| InChI |
InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
| CAS Registry Number |
121219-12-3 |
| Molecular Structure |
|
| Dichte |
1.01g/cm3 |
| Siedepunkt |
328°C at 760 mmHg |
| Brechungsindex |
1.509 |
| Flammpunkt |
152.2°C |
| Dampfdruck |
7.85E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
