ChemNet > CAS > 1214-47-7 1-(2-hydroxyphenyl)-3-phenyl-2-propenone
1214-47-7 1-(2-hydroxyphenyl)-3-phenyl-2-propenone
| Produkt-Name |
1-(2-hydroxyphenyl)-3-phenyl-2-propenone |
| Englischer Name |
1-(2-hydroxyphenyl)-3-phenyl-2-propenone; 2-Hydroxychalcone; Benzylidene(2-hydroxyacetophenone); 1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one; (2E)-1-(2-hydroxyphenyl)-3-phenylprop-2-en-1-one; 2'-Hydroxychalcone; 2'-HYDROXY BENZALACETOPHENONE; 2-Hydroxybenzalacetophenone |
| Molekulare Formel |
C15H12O2 |
| Molecular Weight |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-11,16H/b11-10+ |
| CAS Registry Number |
1214-47-7 |
| EINECS |
214-928-0 |
| Molecular Structure |
|
| Dichte |
1.191g/cm3 |
| Schmelzpunkt |
88-92℃ |
| Siedepunkt |
396.6°C at 760 mmHg |
| Brechungsindex |
1.653 |
| Flammpunkt |
169.4°C |
| Dampfdruck |
7.4E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
