1222-98-6 4-Nitrochalcone
Produkt-Name |
4-Nitrochalcone |
Englischer Name |
4-Nitrochalcone; (4-Nitrobenzylidene)acetophenone; 3-(4-nitrophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-nitrophenyl)-1-phenylprop-2-en-1-one |
Molekulare Formel |
C15H11NO3 |
Molecular Weight |
253.2527 |
InChI |
InChI=1/C15H11NO3/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19/h1-11H/b11-8+ |
CAS Registry Number |
1222-98-6 |
EINECS |
214-949-5 |
Molecular Structure |
|
Dichte |
1.255g/cm3 |
Schmelzpunkt |
158-160℃ |
Siedepunkt |
399.2°C at 760 mmHg |
Brechungsindex |
1.651 |
Flammpunkt |
186.5°C |
Dampfdruck |
1.4E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|