ChemNet > CAS > 123016-51-3 2,3,4,6-Tetrafluorobenzoyl chloride
123016-51-3 2,3,4,6-Tetrafluorobenzoyl chloride
Produkt-Name |
2,3,4,6-Tetrafluorobenzoyl chloride |
Englischer Name |
2,3,4,6-Tetrafluorobenzoyl chloride; -2,3,4,6-TETRAFLUOROBENZOYL CHLORIDE; Benzoyl chloride, 2,3,4,6-tetrafluoro- (9CI) |
Molekulare Formel |
C7HClF4O |
Molecular Weight |
212.5289 |
InChI |
InChI=1/C7HClF4O/c8-7(13)4-2(9)1-3(10)5(11)6(4)12/h1H |
CAS Registry Number |
123016-51-3 |
Molecular Structure |
|
Dichte |
1.601g/cm3 |
Siedepunkt |
158.3°C at 760 mmHg |
Brechungsindex |
1.461 |
Flammpunkt |
49.5°C |
Dampfdruck |
2.64mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|