ChemNet > CAS > 126325-46-0 6-Amino-5-bromo-2-picoline
126325-46-0 6-Amino-5-bromo-2-picoline
| Produkt-Name |
6-Amino-5-bromo-2-picoline |
| Englischer Name |
6-Amino-5-bromo-2-picoline; 2-amino-3-bromo-6-methylpyridine; 3-bromo-6-methylpyridin-2-amine; 2-amino-3-bromo-6-methylpyridinium |
| Molekulare Formel |
C6H8BrN2 |
| Molecular Weight |
188.0446 |
| InChI |
InChI=1/C6H7BrN2/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3,(H2,8,9)/p+1 |
| CAS Registry Number |
126325-46-0 |
| Molecular Structure |
|
| Siedepunkt |
238.5°C at 760 mmHg |
| Flammpunkt |
98.1°C |
| Dampfdruck |
0.0422mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|