ChemNet > CAS > 13026-12-5 3-(1-Naphthyl)acrylic acid
13026-12-5 3-(1-Naphthyl)acrylic acid
| Produkt-Name |
3-(1-Naphthyl)acrylic acid |
| Englischer Name |
3-(1-Naphthyl)acrylic acid;(2E)-3-(naphthalen-1-yl)prop-2-enoic acid; (2E)-3-naphthalen-1-ylprop-2-enal; (2E)-3-naphthalen-1-ylprop-2-enoate; 1-Naphthylacrylic acid |
| Molekulare Formel |
C13H9O2 |
| Molecular Weight |
197.2099 |
| InChI |
InChI=1/C13H10O2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H,(H,14,15)/p-1/b9-8+ |
| CAS Registry Number |
13026-12-5 |
| EINECS |
235-887-5 |
| Molecular Structure |
|
| Siedepunkt |
393.1°C at 760 mmHg |
| Flammpunkt |
290.7°C |
| Dampfdruck |
6.95E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
