13072-69-0 N-(1-Adamantyl)urea
Produkt-Name |
N-(1-Adamantyl)urea |
Englischer Name |
N-(1-Adamantyl)urea; |
Molekulare Formel |
C11H18N2O |
Molecular Weight |
194.2734 |
InChI |
InChI=1/C11H18N2O/c12-10(14)13-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H3,12,13,14) |
CAS Registry Number |
13072-69-0 |
EINECS |
235-965-9 |
Molecular Structure |
|
Dichte |
1.17g/cm3 |
Schmelzpunkt |
250℃ |
Siedepunkt |
309.5°C at 760 mmHg |
Brechungsindex |
1.57 |
Flammpunkt |
141°C |
Dampfdruck |
0.000639mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|