13194-67-7 4-fluoro-2-iodotoluene
Produkt-Name |
4-fluoro-2-iodotoluene |
Englischer Name |
4-fluoro-2-iodotoluene; 4-Fluoro-2-iodo-1-methylbenzene |
Molekulare Formel |
C7H6FI |
Molecular Weight |
236.0254 |
InChI |
InChI=1/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
CAS Registry Number |
13194-67-7 |
EINECS |
236-153-7 |
Molecular Structure |
|
Dichte |
1.788g/cm3 |
Siedepunkt |
205.1°C at 760 mmHg |
Brechungsindex |
1.58 |
Flammpunkt |
81°C |
Dampfdruck |
0.364mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|