ChemNet > CAS > 132546-81-7 methyl 6-morpholinonicotinate
132546-81-7 methyl 6-morpholinonicotinate
| Produkt-Name |
methyl 6-morpholinonicotinate |
| Englischer Name |
methyl 6-morpholinonicotinate;methyl 6-morpholin-4-ylpyridine-3-carboxylate |
| Molekulare Formel |
C11H14N2O3 |
| Molecular Weight |
222.2405 |
| InChI |
InChI=1/C11H14N2O3/c1-15-11(14)9-2-3-10(12-8-9)13-4-6-16-7-5-13/h2-3,8H,4-7H2,1H3 |
| CAS Registry Number |
132546-81-7 |
| Molecular Structure |
|
| Dichte |
1.208g/cm3 |
| Schmelzpunkt |
109℃ |
| Siedepunkt |
383.6°C at 760 mmHg |
| Brechungsindex |
1.542 |
| Flammpunkt |
185.8°C |
| Dampfdruck |
4.36E-06mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
