ChemNet > CAS > 132898-95-4 2,2'-Bithiophen-5-boronsäure
132898-95-4 2,2'-Bithiophen-5-boronsäure
| Produkt-Name |
2,2'-Bithiophen-5-boronsäure |
| Synonyme |
2,2'-Bithiophen-5-ylboronsäure |
| Englischer Name |
2,2'-bithiophene-5-boronic acid;2,2'-bithiophen-5-ylboronic acid |
| Molekulare Formel |
C8H7BO2S2 |
| Molecular Weight |
210.081 |
| InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
| CAS Registry Number |
132898-95-4 |
| Molecular Structure |
|
| Dichte |
1.42g/cm3 |
| Schmelzpunkt |
127℃ |
| Siedepunkt |
416.1°C at 760 mmHg |
| Brechungsindex |
1.658 |
| Flammpunkt |
205.5°C |
| Dampfdruck |
1.14E-07mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
