133-11-9 Phenyl 4-aminosalicylate
Produkt-Name |
Phenyl 4-aminosalicylate |
Englischer Name |
Phenyl 4-aminosalicylate; 4-Amino-2-hydroxybenzoic acid phenyl ester; Phenyl PAS; fenamisal; Phenyl Aminosalicylate;
; phenyl 4-amino-2-hydroxybenzoate |
Molekulare Formel |
C13H11NO3 |
Molecular Weight |
229.2313 |
InChI |
InChI=1/C13H11NO3/c14-9-6-7-11(12(15)8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H,14H2 |
CAS Registry Number |
133-11-9 |
EINECS |
205-092-8 |
Molecular Structure |
|
Dichte |
1.32g/cm3 |
Schmelzpunkt |
147-152℃ |
Siedepunkt |
406.4°C at 760 mmHg |
Brechungsindex |
1.659 |
Flammpunkt |
199.6°C |
Dampfdruck |
3.48E-07mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|