ChemNet > CAS > 13368-86-0 1,2,5-Thiadiazol-3-carbonsäure
13368-86-0 1,2,5-Thiadiazol-3-carbonsäure
| Produkt-Name |
1,2,5-Thiadiazol-3-carbonsäure |
| Englischer Name |
1,2,5-Thiadiazole-3-carboxylic acid; |
| Molekulare Formel |
C3H2N2O2S |
| Molecular Weight |
130.1252 |
| InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-4-8-5-2/h1H,(H,6,7) |
| CAS Registry Number |
13368-86-0 |
| Molecular Structure |
|
| Dichte |
1.67g/cm3 |
| Schmelzpunkt |
89℃ |
| Siedepunkt |
292.8°C at 760 mmHg |
| Brechungsindex |
1.631 |
| Flammpunkt |
130.9°C |
| Dampfdruck |
0.000817mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
