ChemNet > CAS > 13455-00-0 Diphosphorus tetraiodide
13455-00-0 Diphosphorus tetraiodide
| Produkt-Name |
Diphosphorus tetraiodide |
| Englischer Name |
Diphosphorus tetraiodide; Phosphorus diiodide; tetraiododiphosphane |
| Molekulare Formel |
I4P2 |
| Molecular Weight |
569.5654 |
| InChI |
InChI=1/I4P2/c1-5(2)6(3)4 |
| CAS Registry Number |
13455-00-0 |
| EINECS |
236-646-7 |
| Molecular Structure |
|
| Schmelzpunkt |
125-128℃ |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|
