ChemNet > CAS > 13506-76-8 2-Methyl-6-nitrobenzoic acid
13506-76-8 2-Methyl-6-nitrobenzoic acid
| Produkt-Name |
2-Methyl-6-nitrobenzoic acid |
| Englischer Name |
2-Methyl-6-nitrobenzoic acid; 6-Nitro-o-toluic acid; 2-methyl-6-nitrobenzoate |
| Molekulare Formel |
C8H6NO4 |
| Molecular Weight |
180.1381 |
| InChI |
InChI=1/C8H7NO4/c1-5-3-2-4-6(9(12)13)7(5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
| CAS Registry Number |
13506-76-8 |
| EINECS |
236-833-3 |
| Molecular Structure |
|
| Schmelzpunkt |
154-157℃ |
| Siedepunkt |
352.8°C at 760 mmHg |
| Flammpunkt |
159.7°C |
| Dampfdruck |
1.38E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
