13631-21-5 4-Bromo-3-chlorophenol
Produkt-Name |
4-Bromo-3-chlorophenol |
Englischer Name |
4-Bromo-3-chlorophenol; |
Molekulare Formel |
C6H4BrClO |
Molecular Weight |
207.4524 |
InChI |
InChI=1/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
CAS Registry Number |
13631-21-5 |
Molecular Structure |
|
Dichte |
1.788g/cm3 |
Siedepunkt |
267.5°C at 760 mmHg |
Brechungsindex |
1.619 |
Flammpunkt |
115.6°C |
Dampfdruck |
0.00493mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|