ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
| Produkt-Name |
2-acetyl-3-methylthiophene |
| Englischer Name |
2-acetyl-3-methylthiophene; 1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| Molekulare Formel |
C7H8OS |
| Molecular Weight |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| CAS Registry Number |
13679-72-6 |
| EINECS |
237-179-1 |
| Molecular Structure |
|
| Dichte |
1.106g/cm3 |
| Siedepunkt |
214.9°C at 760 mmHg |
| Brechungsindex |
1.535 |
| Flammpunkt |
92.3°C |
| Dampfdruck |
0.152mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
