13720-06-4 2,6-Dibromonaphthalene
Produkt-Name |
2,6-Dibromonaphthalene |
Englischer Name |
2,6-Dibromonaphthalene; |
Molekulare Formel |
C10H6Br2 |
Molecular Weight |
285.9626 |
InChI |
InChI=1/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H |
CAS Registry Number |
13720-06-4 |
Molecular Structure |
|
Dichte |
1.834g/cm3 |
Siedepunkt |
339.1°C at 760 mmHg |
Brechungsindex |
1.688 |
Flammpunkt |
184.7°C |
Dampfdruck |
0.000184mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|