ChemNet > CAS > 13720-06-4 2,6-Dibromonaphthalene
13720-06-4 2,6-Dibromonaphthalene
| Produkt-Name |
2,6-Dibromonaphthalene |
| Englischer Name |
2,6-Dibromonaphthalene; |
| Molekulare Formel |
C10H6Br2 |
| Molecular Weight |
285.9626 |
| InChI |
InChI=1/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H |
| CAS Registry Number |
13720-06-4 |
| Molecular Structure |
|
| Dichte |
1.834g/cm3 |
| Siedepunkt |
339.1°C at 760 mmHg |
| Brechungsindex |
1.688 |
| Flammpunkt |
184.7°C |
| Dampfdruck |
0.000184mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
