ChemNet > CAS > 14199-83-8 1-Desoxy-1-nitro-D-mannitol
14199-83-8 1-Desoxy-1-nitro-D-mannitol
| Produkt-Name |
1-Desoxy-1-nitro-D-mannitol |
| Synonyme |
AI3-62628; D-Mannit, 1-Desoxy-1-nitro-; 1-Desoxy-1-nitrohexitol |
| Englischer Name |
1-Deoxy-1-nitro-D-mannitol;AI3-62628; D-Mannitol, 1-deoxy-1-nitro-; 1-deoxy-1-nitrohexitol |
| Molekulare Formel |
C6H13NO7 |
| Molecular Weight |
211.1699 |
| InChI |
InChI=1/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| CAS Registry Number |
14199-83-8 |
| EINECS |
238-051-8 |
| Molecular Structure |
|
| Dichte |
1.632g/cm3 |
| Schmelzpunkt |
133℃ |
| Siedepunkt |
608.3°C at 760 mmHg |
| Brechungsindex |
1.585 |
| Flammpunkt |
269°C |
| Dampfdruck |
2.45E-17mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|