1422-54-4 2-Bromo-6-fluorotoluene
Produkt-Name |
2-Bromo-6-fluorotoluene |
Englischer Name |
2-Bromo-6-fluorotoluene; Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
Molekulare Formel |
C7H4ClFN2S |
Molecular Weight |
202.6365 |
InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
CAS Registry Number |
1422-54-4 |
Molecular Structure |
|
Dichte |
1.63g/cm3 |
Siedepunkt |
294°C at 760 mmHg |
Brechungsindex |
1.714 |
Flammpunkt |
131.6°C |
Dampfdruck |
0.00166mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|