14309-57-0 3-Nonen-2-one
Produkt-Name |
3-Nonen-2-one |
Englischer Name |
3-Nonen-2-one;non-3-en-2-one; (3E)-non-3-en-2-one; (3Z)-non-3-en-2-one |
Molekulare Formel |
C9H16O |
Molecular Weight |
140.2227 |
InChI |
InChI=1/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7- |
CAS Registry Number |
14309-57-0 |
EINECS |
238-248-9 |
Molecular Structure |
|
Dichte |
0.835g/cm3 |
Siedepunkt |
201.9°C at 760 mmHg |
Brechungsindex |
1.435 |
Flammpunkt |
81.3°C |
Dampfdruck |
0.301mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|