ChemNet > CAS > 1440-61-5 4-(2-Chloroacetyl)morpholine
1440-61-5 4-(2-Chloroacetyl)morpholine
| Produkt-Name |
4-(2-Chloroacetyl)morpholine |
| Englischer Name |
4-(2-Chloroacetyl)morpholine; 2-Chloro-1-morpholinoethan-1-one; 2-chloro-1-(morpholin-4-yl)ethanone |
| Molekulare Formel |
C6H10ClNO2 |
| Molecular Weight |
163.6021 |
| InChI |
InChI=1/C6H10ClNO2/c7-5-6(9)8-1-3-10-4-2-8/h1-5H2 |
| CAS Registry Number |
1440-61-5 |
| EINECS |
215-880-3 |
| Molecular Structure |
|
| Dichte |
1.246g/cm3 |
| Schmelzpunkt |
27-30 °C |
| Siedepunkt |
294.2°C at 760 mmHg |
| Brechungsindex |
1.486 |
| Flammpunkt |
131.8°C |
| Dampfdruck |
0.00164mmHg at 25°C |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
