ChemNet > CAS > 144284-25-3 2,4,5-trifluorobenzyl alcohol
144284-25-3 2,4,5-trifluorobenzyl alcohol
| Produkt-Name |
2,4,5-trifluorobenzyl alcohol |
| Englischer Name |
2,4,5-trifluorobenzyl alcohol; (2,4,5-trifluorophenyl)methanol |
| Molekulare Formel |
C7H5F3O |
| Molecular Weight |
162.11 |
| InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
| CAS Registry Number |
144284-25-3 |
| Molecular Structure |
|
| Dichte |
1.858g/cm3 |
| Siedepunkt |
213.308°C at 760 mmHg |
| Brechungsindex |
1.55 |
| Flammpunkt |
82.806°C |
| Dampfdruck |
0.113mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
