ChemNet > CAS > 145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
Produkt-Name |
Methyl 2,5-dichlorothiophene-3-carboxylate |
Englischer Name |
Methyl 2,5-dichlorothiophene-3-carboxylate; 2,5-Dichlorothiophene-3-carboxylic acid methyl ester |
Molekulare Formel |
C6H4Cl2O2S |
Molecular Weight |
211.0658 |
InChI |
InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3 |
CAS Registry Number |
145129-54-0 |
Molecular Structure |
|
Dichte |
1.5g/cm3 |
Siedepunkt |
257.3°C at 760 mmHg |
Brechungsindex |
1.57 |
Flammpunkt |
109.4°C |
Dampfdruck |
0.0146mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|