ChemNet > CAS > 145689-34-5 2,3-difluorophenylacetonitrile
145689-34-5 2,3-difluorophenylacetonitrile
Produkt-Name |
2,3-difluorophenylacetonitrile |
Englischer Name |
2,3-difluorophenylacetonitrile; 2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
Molekulare Formel |
C8H5F2N |
Molecular Weight |
153.1288 |
InChI |
InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
CAS Registry Number |
145689-34-5 |
Molecular Structure |
|
Dichte |
1.234g/cm3 |
Siedepunkt |
216.9°C at 760 mmHg |
Brechungsindex |
1.487 |
Flammpunkt |
85°C |
Dampfdruck |
0.136mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|