ChemNet > CAS > 1457-47-2 N-Allylrhodanine
1457-47-2 N-Allylrhodanine
| Produkt-Name |
N-Allylrhodanine |
| Englischer Name |
N-Allylrhodanine; |
| Molekulare Formel |
C6H7NOS2 |
| Molecular Weight |
173.2559 |
| InChI |
InChI=1/C6H7NOS2/c1-2-3-7-5(8)4-10-6(7)9/h2H,1,3-4H2 |
| CAS Registry Number |
1457-47-2 |
| EINECS |
215-941-4 |
| Molecular Structure |
|
| Dichte |
1.35g/cm3 |
| Schmelzpunkt |
43-46℃ |
| Siedepunkt |
248.8°C at 760 mmHg |
| Brechungsindex |
1.651 |
| Flammpunkt |
104.3°C |
| Dampfdruck |
0.0238mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
