ChemNet > CAS > 1460-18-0 1,15-Pentadecanedioic acid
1460-18-0 1,15-Pentadecanedioic acid
| Produkt-Name |
1,15-Pentadecanedioic acid |
| Englischer Name |
1,15-Pentadecanedioic acid; Pentadecanedioic acid |
| Molekulare Formel |
C15H28O4 |
| Molecular Weight |
272.3804 |
| InChI |
InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
| CAS Registry Number |
1460-18-0 |
| Molecular Structure |
|
| Dichte |
1.026g/cm3 |
| Schmelzpunkt |
113-114℃ |
| Siedepunkt |
445.8°C at 760 mmHg |
| Brechungsindex |
1.474 |
| Flammpunkt |
237.5°C |
| Dampfdruck |
3.44E-09mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
