1466-88-2 o-Nitrocinnamaldehyde
Produkt-Name |
o-Nitrocinnamaldehyde |
Englischer Name |
o-Nitrocinnamaldehyde; 2-Nitrocinnamaldehyde; 3-(2-nitrophenyl)prop-2-enal; (2E)-3-(2-nitrophenyl)prop-2-enal |
Molekulare Formel |
C9H7NO3 |
Molecular Weight |
177.1568 |
InChI |
InChI=1/C9H7NO3/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-7H/b5-3+ |
CAS Registry Number |
1466-88-2 |
EINECS |
215-988-0 |
Molecular Structure |
|
Dichte |
1.269g/cm3 |
Schmelzpunkt |
125-126℃ |
Siedepunkt |
348.1°C at 760 mmHg |
Brechungsindex |
1.617 |
Flammpunkt |
178.1°C |
Dampfdruck |
5.15E-05mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|