ChemNet > CAS > 14852-31-4 2-Hexadecanol
14852-31-4 2-Hexadecanol
| Produkt-Name |
2-Hexadecanol |
| Englischer Name |
2-Hexadecanol;Hexadecan-2-ol; AI3-35278; NSC 87605 |
| Molekulare Formel |
C16H34O |
| Molecular Weight |
242.4406 |
| InChI |
InChI=1/C16H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17/h16-17H,3-15H2,1-2H3 |
| CAS Registry Number |
14852-31-4 |
| EINECS |
238-917-5 |
| Molecular Structure |
|
| Dichte |
0.834g/cm3 |
| Schmelzpunkt |
43-48℃ |
| Siedepunkt |
314°C at 760 mmHg |
| Brechungsindex |
1.447 |
| Flammpunkt |
111.3°C |
| Dampfdruck |
4.14E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
