ChemNet > CAS > 14984-21-5 Bis(4-phenoxyphenyl)methanone
14984-21-5 Bis(4-phenoxyphenyl)methanone
Produkt-Name |
Bis(4-phenoxyphenyl)methanone |
Englischer Name |
Bis(4-phenoxyphenyl)methanone; 4,4-Diphenoxybenzophenone; 4,4'-Diphenoxybenzophenone |
Molekulare Formel |
C25H18O3 |
Molecular Weight |
366.4086 |
InChI |
InChI=1/C25H18O3/c26-25(19-11-15-23(16-12-19)27-21-7-3-1-4-8-21)20-13-17-24(18-14-20)28-22-9-5-2-6-10-22/h1-18H |
CAS Registry Number |
14984-21-5 |
EINECS |
403-390-4 |
Molecular Structure |
|
Dichte |
1.186g/cm3 |
Siedepunkt |
514.4°C at 760 mmHg |
Brechungsindex |
1.623 |
Flammpunkt |
257.3°C |
Dampfdruck |
1.08E-10mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|