150-61-8 1,2-Dianilinoethane
Produkt-Name |
1,2-Dianilinoethane |
Englischer Name |
1,2-Dianilinoethane; N,N-Diphenylethylenediamine; Wanzlicks; 1,2-Dianilinoethane, Pract.; N,N-ethylenedianiline; NN-Diphenylethylenediamine; 1,2-Diphenyl Ethanediamine; N,N'-diphenylethane-1,2-diamine; N,N'-diphenylethane-1,2-diaminium |
Molekulare Formel |
C14H16N2 |
Molecular Weight |
212.2902 |
InChI |
InChI=1/C14H16N2/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,15H2 |
CAS Registry Number |
150-61-8 |
EINECS |
205-765-6 |
Molecular Structure |
|
Dichte |
1.093g/cm3 |
Schmelzpunkt |
64-67℃ |
Siedepunkt |
351.529°C at 760 mmHg |
Brechungsindex |
1.623 |
Flammpunkt |
148.617°C |
Dampfdruck |
0mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|