ChemNet > CAS > 153912-60-8 (1,5-dimethyl-1H-pyrazol-3-yl)methanol
153912-60-8 (1,5-dimethyl-1H-pyrazol-3-yl)methanol
| Produkt-Name |
(1,5-dimethyl-1H-pyrazol-3-yl)methanol |
| Englischer Name |
(1,5-dimethyl-1H-pyrazol-3-yl)methanol; |
| Molekulare Formel |
C6H10N2O |
| Molecular Weight |
126.1564 |
| InChI |
InChI=1/C6H10N2O/c1-5-3-6(4-9)7-8(5)2/h3,9H,4H2,1-2H3 |
| CAS Registry Number |
153912-60-8 |
| Molecular Structure |
|
| Dichte |
1.13g/cm3 |
| Siedepunkt |
248.6°C at 760 mmHg |
| Brechungsindex |
1.543 |
| Flammpunkt |
104.1°C |
| Dampfdruck |
0.0127mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
