ChemNet > CAS > 15414-98-9 Triphenylcarbeniumpentachlorostannat
15414-98-9 Triphenylcarbeniumpentachlorostannat
| Produkt-Name |
Triphenylcarbeniumpentachlorostannat |
| Synonyme |
Trithylpentachlorostannat; Zinn(4 )triphenylmethylchlorid (1:1:5) |
| Englischer Name |
Triphenylcarbenium pentachlorostannate; Trityl pentachlorostannate; tin(4+) triphenylmethylium chloride (1:1:5) |
| Molekulare Formel |
C19H15Cl5Sn |
| Molecular Weight |
539.2974 |
| InChI |
InChI=1/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
| CAS Registry Number |
15414-98-9 |
| EINECS |
239-426-9 |
| Molecular Structure |
|
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
