ChemNet > CAS > 15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
| Produkt-Name |
2-(3-Methoxyphenyl)cyclohexanone |
| Englischer Name |
2-(3-Methoxyphenyl)cyclohexanone;Cyclohexanone, 2-(3-methoxyphenyl)-; (2R)-2-(3-methoxyphenyl)cyclohexanone; (2S)-2-(3-methoxyphenyl)cyclohexanone |
| Molekulare Formel |
C13H16O2 |
| Molecular Weight |
204.2649 |
| InChI |
InChI=1/C13H16O2/c1-15-11-6-4-5-10(9-11)12-7-2-3-8-13(12)14/h4-6,9,12H,2-3,7-8H2,1H3/t12-/m0/s1 |
| CAS Registry Number |
15547-89-4 |
| EINECS |
239-602-5 |
| Molecular Structure |
|
| Dichte |
1.068g/cm3 |
| Siedepunkt |
332.6°C at 760 mmHg |
| Brechungsindex |
1.528 |
| Flammpunkt |
147.8°C |
| Dampfdruck |
0.000144mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
