1562-90-9 Celestine Blue
Produkt-Name |
Celestine Blue |
Englischer Name |
Celestine Blue;C.I. 51050; C.I. Mordant Blue 14 (8CI); Celestine blue; celestine blue (C.I. 51050); [7-(diethylamino)-3,4-dioxo-4,10-dihydro-3H-phenoxazin-1-yl](hydroxy)methaniminium chloride; 1-carbamoyl-7-(diethylamino)-3,4-dihydroxyphenoxazin-5-ium chloride |
Molekulare Formel |
C17H18ClN3O4 |
Molecular Weight |
363.7955 |
InChI |
InChI=1/C17H17N3O4.ClH/c1-3-20(4-2)9-5-6-11-13(7-9)24-16-14(19-11)10(17(18)23)8-12(21)15(16)22;/h5-8H,3-4H2,1-2H3,(H3-,18,19,21,22,23);1H |
CAS Registry Number |
1562-90-9 |
EINECS |
216-346-2 |
Molecular Structure |
|
Schmelzpunkt |
227-230℃ |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|