ChemNet > CAS > 1589-60-2 1-Phenyl-1-cyclohexanol
1589-60-2 1-Phenyl-1-cyclohexanol
| Produkt-Name |
1-Phenyl-1-cyclohexanol |
| Englischer Name |
1-Phenyl-1-cyclohexanol; 1-Phenylcyclohexanol |
| Molekulare Formel |
C12H16O |
| Molecular Weight |
176.2548 |
| InChI |
InChI=1/C12H16O/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h1,3-4,7-8,13H,2,5-6,9-10H2 |
| CAS Registry Number |
1589-60-2 |
| EINECS |
216-456-0 |
| Molecular Structure |
|
| Dichte |
1.061g/cm3 |
| Schmelzpunkt |
58-62℃ |
| Siedepunkt |
295.1°C at 760 mmHg |
| Brechungsindex |
1.558 |
| Flammpunkt |
113.1°C |
| Dampfdruck |
0.000704mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
