1590-08-5 2-Methyl-1-tetralone
Produkt-Name |
2-Methyl-1-tetralone |
Englischer Name |
2-Methyl-1-tetralone; 1,2,3,4-tetrahydro-2-methylnaphthalen-1-one; 2-methyl-3,4-dihydronaphthalen-1(2H)-one; (2R)-2-methyl-3,4-dihydronaphthalen-1(2H)-one; (2S)-2-methyl-3,4-dihydronaphthalen-1(2H)-one |
Molekulare Formel |
C11H12O |
Molecular Weight |
160.2124 |
InChI |
InChI=1/C11H12O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-5,8H,6-7H2,1H3/t8-/m0/s1 |
CAS Registry Number |
1590-08-5 |
EINECS |
216-461-8 |
Molecular Structure |
|
Dichte |
1.048g/cm3 |
Siedepunkt |
262.3°C at 760 mmHg |
Brechungsindex |
1.539 |
Flammpunkt |
107°C |
Dampfdruck |
0.011mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|