16205-90-6 Ethyl 2-hexynoate
Produkt-Name |
Ethyl 2-hexynoate |
Englischer Name |
Ethyl 2-hexynoate; 2-Hexynoic acid ethyl ester; ethyl hex-2-ynoate |
Molekulare Formel |
C8H12O2 |
Molecular Weight |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3-5H2,1-2H3 |
CAS Registry Number |
16205-90-6 |
EINECS |
240-335-1 |
Molecular Structure |
|
Dichte |
0.951g/cm3 |
Siedepunkt |
205.1°C at 760 mmHg |
Brechungsindex |
1.44 |
Flammpunkt |
76.9°C |
Dampfdruck |
0.255mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|