ChemNet > CAS > 1631-83-0 Diphenylchlorosilane
1631-83-0 Diphenylchlorosilane
| Produkt-Name |
Diphenylchlorosilane |
| Englischer Name |
Diphenylchlorosilane; Chlorodiphenylsilane; chloro(diphenyl)silyl |
| Molekulare Formel |
C12H10ClSi |
| Molecular Weight |
217.7463 |
| InChI |
InChI=1/C12H10ClSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| CAS Registry Number |
1631-83-0 |
| EINECS |
216-634-8 |
| Molecular Structure |
|
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
