ChemNet > CAS > 1634-82-8 2-(4-Hydroxyphenylazo)benzoic acid
1634-82-8 2-(4-Hydroxyphenylazo)benzoic acid
Produkt-Name |
2-(4-Hydroxyphenylazo)benzoic acid |
Englischer Name |
2-(4-Hydroxyphenylazo)benzoic acid; haba (2-(4-hydroxyphenylazo)benzoic acid); 4-hydroxyazobenzene-2-carboxylic acid; Alpha-Hydroxy-Gamma-Amino-Butyric Acid; 2-(4-Hydroxyazobenzene)benzoic acid HABA; 2-(p-hydroxyphenylazo)benzoic acid; 2-[2-(4-oxocyclohexa-2,5-dien-1-ylidene)hydrazino]benzoic acid; 2-[2-(4-oxocyclohexa-2,5-dien-1-ylidene)hydrazino]benzoate; 2-[(E)-(4-hydroxyphenyl)diazenyl]benzoic acid |
Molekulare Formel |
C13H10N2O3 |
Molecular Weight |
242.2301 |
InChI |
InChI=1/C13H10N2O3/c16-10-7-5-9(6-8-10)14-15-12-4-2-1-3-11(12)13(17)18/h1-8,16H,(H,17,18)/b15-14+ |
CAS Registry Number |
1634-82-8 |
EINECS |
216-655-2 |
Molecular Structure |
|
Dichte |
1.301g/cm3 |
Schmelzpunkt |
203-208℃ |
Siedepunkt |
493.995°C at 760 mmHg |
Brechungsindex |
1.627 |
Flammpunkt |
252.559°C |
Dampfdruck |
0mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|