ChemNet > CAS > 163517-62-2 5-fluoro-2-methylphenylboronic acid
163517-62-2 5-fluoro-2-methylphenylboronic acid
Produkt-Name |
5-fluoro-2-methylphenylboronic acid |
Englischer Name |
5-fluoro-2-methylphenylboronic acid; 5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid; 5-Fluoro-2-methylbenzeneboronic acid |
Molekulare Formel |
C7H8BFO2 |
Molecular Weight |
153.9466 |
InChI |
InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
CAS Registry Number |
163517-62-2 |
Molecular Structure |
|
Dichte |
1.2g/cm3 |
Siedepunkt |
287.7°C at 760 mmHg |
Brechungsindex |
1.505 |
Flammpunkt |
127.8°C |
Dampfdruck |
0.00113mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|