| Produkt-Name |
2-Amino-4-hydroxy-6-methyl-1,3,5-triazin |
| Synonyme |
4-Amino-6-methyl-1,3,5-triazin-2(1H)-on; 4-Amino-6-methyl-1,3,5-triazin-2-ol; 4-Amino-6-methyl-1,3,5-triazin-2(5H)-on |
| Englischer Name |
2-Amino-4-hydroxy-6-methyl-1,3,5-triazine; 4-Amino-6-methyl-1,3,5-triazin-2(1H)-one; 4-Amino-6-methyl-1,3,5-triazin-2-ol; 4-amino-6-methyl-1,3,5-triazin-2(5H)-one |
| Molekulare Formel |
C4H6N4O |
| Molecular Weight |
126.1166 |
| InChI |
InChI=1/C4H6N4O/c1-2-6-3(5)8-4(9)7-2/h1H3,(H3,5,6,7,8,9) |
| CAS Registry Number |
16352-06-0 |
| Molecular Structure |
|
| Dichte |
1.67g/cm3 |
| Schmelzpunkt |
350℃ |
| Siedepunkt |
233.3°C at 760 mmHg |
| Brechungsindex |
1.731 |
| Flammpunkt |
94.9°C |
| Dampfdruck |
0.0564mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|